About Anilinopyrazole deriv. 1n
Anilinopyrazole deriv. 1n (PubChem CID 6539622) has the molecular formula C23H18F4N6O3S
and a molecular weight of 534.50 g/mol. Its IUPAC name is 1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[3-[3-(4-sulfamoylanilino)-1H-pyrazol-5-yl]phenyl]urea.
Molecular Properties
| Compound Name | Anilinopyrazole deriv. 1n |
| PubChem CID | 6539622 |
| Molecular Formula | C23H18F4N6O3S |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[3-[3-(4-sulfamoylanilino)-1H-pyrazol-5-yl]phenyl]urea |
| SMILES | C1=CC(=CC(=C1)NC(=O)NC2=C(C=CC(=C2)C(F)(F)F)F)C3=CC(=NN3)NC4=CC=C(C=C4)S(=O)(=O)N |
| InChI | InChI=1S/C23H18F4N6O3S/c24-18-9-4-14(23(25,26)27)11-20(18)31-22(34)30-16-3-1-2-13(10-16)19-12-21(33-32-19)29-15-5-7-17(8-6-15)37(28,35)36/h1-12H,(H2,28,35,36)(H2,29,32,33)(H2,30,31,34) |
| InChIKey | RSDHVIKBVVEOQN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | 881 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze Anilinopyrazole deriv. 1n with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Anilinopyrazole deriv. 1n?
The IUPAC name of Anilinopyrazole deriv. 1n (CID 6539622) is 1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[3-[3-(4-sulfamoylanilino)-1H-pyrazol-5-yl]phenyl]urea.
What is the SMILES notation for Anilinopyrazole deriv. 1n?
The canonical SMILES for Anilinopyrazole deriv. 1n is C1=CC(=CC(=C1)NC(=O)NC2=C(C=CC(=C2)C(F)(F)F)F)C3=CC(=NN3)NC4=CC=C(C=C4)S(=O)(=O)N.
What is the InChIKey of Anilinopyrazole deriv. 1n?
The InChIKey is RSDHVIKBVVEOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F4N6O3S/c24-18-9-4-14(23(25,26)27)11-20(18)31-22(34)30-16-3-1-2-13(10-16)19-12-21(33-32-19)29-15-5-7-17(8-6-15)37(28,35)36/h1-12H,(H2,28,35,36)(H2,29,32,33)(H2,30,31,34).
What are the key properties of Anilinopyrazole deriv. 1n?
Anilinopyrazole deriv. 1n has a molecular weight of 534.50 g/mol, XLogP of 3.90, 6 rotatable bonds, 5 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for Anilinopyrazole deriv. 1n is sourced from PubChem (CID 6539622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).