About 4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide
4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide (PubChem CID 6539631) has the molecular formula C19H21N5O3S
and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-[[5-(3-morpholin-4-ylphenyl)-1H-pyrazol-3-yl]amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide |
| PubChem CID | 6539631 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-[[5-(3-morpholin-4-ylphenyl)-1H-pyrazol-3-yl]amino]benzenesulfonamide |
| SMILES | C1COCCN1C2=CC=CC(=C2)C3=CC(=NN3)NC4=CC=C(C=C4)S(=O)(=O)N |
| InChI | InChI=1S/C19H21N5O3S/c20-28(25,26)17-6-4-15(5-7-17)21-19-13-18(22-23-19)14-2-1-3-16(12-14)24-8-10-27-11-9-24/h1-7,12-13H,8-11H2,(H2,20,25,26)(H2,21,22,23) |
| InChIKey | OTYOSKLKYVXQAT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | 599 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide?
The IUPAC name of 4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide (CID 6539631) is 4-[[5-(3-morpholin-4-ylphenyl)-1H-pyrazol-3-yl]amino]benzenesulfonamide.
What is the SMILES notation for 4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide?
The canonical SMILES for 4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide is C1COCCN1C2=CC=CC(=C2)C3=CC(=NN3)NC4=CC=C(C=C4)S(=O)(=O)N.
What is the InChIKey of 4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide?
The InChIKey is OTYOSKLKYVXQAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O3S/c20-28(25,26)17-6-4-15(5-7-17)21-19-13-18(22-23-19)14-2-1-3-16(12-14)24-8-10-27-11-9-24/h1-7,12-13H,8-11H2,(H2,20,25,26)(H2,21,22,23).
What are the key properties of 4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide?
4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide has a molecular weight of 399.50 g/mol, XLogP of 2.10, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-({3-[3-(morpholin-4-yl)phenyl]-1H-pyrazol-5-yl}amino)benzene-1-sulfonamide is sourced from PubChem (CID 6539631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).