C13H15Cl2NO4S — CID 65396604
4-chloro-3-(oxan-3-ylmethylcarbamoyl)benzenesulfonyl chloride (PubChem CID 65396604) has the molecular formula C13H15Cl2NO4S and a molecular weight of 352.24 g/mol. Its IUPAC name is 4-chloro-3-(oxan-3-ylmethylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 4-chloro-3-(oxan-3-ylmethylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65396604 |
| Molecular Formula | C13H15Cl2NO4S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 4-chloro-3-(oxan-3-ylmethylcarbamoyl)benzenesulfonyl chloride |
| SMILES | O=C(NCC1CCCOC1)c1cc(S(=O)(=O)Cl)ccc1Cl |
| InChI | InChI=1S/C13H15Cl2NO4S/c14-12-4-3-10(21(15,18)19)6-11(12)13(17)16-7-9-2-1-5-20-8-9/h3-4,6,9H,1-2,5,7-8H2,(H,16,17) |
| InChIKey | YEKWHFQRRSYTKS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |