C12H18N2O4S — CID 6539662
(2R)-N-hydroxy-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanamide (PubChem CID 6539662) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is (2R)-N-hydroxy-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanamide.
| Compound Name | (2R)-N-hydroxy-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 6539662 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (2R)-N-hydroxy-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C(=O)NO)C(C)C)cc1 |
| InChI | InChI=1S/C12H18N2O4S/c1-8(2)11(12(15)13-16)14-19(17,18)10-6-4-9(3)5-7-10/h4-8,11,14,16H,1-3H3,(H,13,15)/t11-/m1/s1 |
| InChIKey | PHTDYRLBGIJZIK-LLVKDONJSA-N |
| XLogP | 0.80 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|