About tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate
tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate (PubChem CID 65397126) has the molecular formula C14H19ClO4S
and a molecular weight of 318.82 g/mol. Its IUPAC name is tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate.
Molecular Properties
| Compound Name | tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate |
| PubChem CID | 65397126 |
| Molecular Formula | C14H19ClO4S |
| Molecular Weight | 318.82 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19ClO4S/c1-8-7-9(2)12(20(15,17)18)10(3)11(8)13(16)19-14(4,5)6/h7H,1-6H3 |
| InChIKey | QGARVABFOCMQII-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate?
The IUPAC name of tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate (CID 65397126) is tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate.
What is the SMILES notation for tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate?
The canonical SMILES for tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate is Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate?
The InChIKey is QGARVABFOCMQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClO4S/c1-8-7-9(2)12(20(15,17)18)10(3)11(8)13(16)19-14(4,5)6/h7H,1-6H3.
What are the key properties of tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate?
tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate has a molecular weight of 318.82 g/mol, XLogP of 3.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-chlorosulfonyl-2,4,6-trimethylbenzoate is sourced from PubChem (CID 65397126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).