About N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide
N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide (PubChem CID 6539758) has the molecular formula C17H16N4O2
and a molecular weight of 308.34 g/mol. Its IUPAC name is N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide |
| PubChem CID | 6539758 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide |
| SMILES | O=C(Nc1ncnc2oc(-c3cccnc3)cc12)C1CCCC1 |
| InChI | InChI=1S/C17H16N4O2/c22-16(11-4-1-2-5-11)21-15-13-8-14(12-6-3-7-18-9-12)23-17(13)20-10-19-15/h3,6-11H,1-2,4-5H2,(H,19,20,21,22) |
| InChIKey | ZSPPFDDJLOSQKQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide?
The IUPAC name of N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide (CID 6539758) is N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide.
What is the SMILES notation for N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide?
The canonical SMILES for N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide is O=C(Nc1ncnc2oc(-c3cccnc3)cc12)C1CCCC1.
What is the InChIKey of N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide?
The InChIKey is ZSPPFDDJLOSQKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2/c22-16(11-4-1-2-5-11)21-15-13-8-14(12-6-3-7-18-9-12)23-17(13)20-10-19-15/h3,6-11H,1-2,4-5H2,(H,19,20,21,22).
What are the key properties of N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide?
N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide has a molecular weight of 308.34 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-pyridin-3-ylfuro[2,3-d]pyrimidin-4-yl)cyclopentanecarboxamide is sourced from PubChem (CID 6539758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).