About 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine
4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine (PubChem CID 6539786) has the molecular formula C15H13N
and a molecular weight of 207.28 g/mol. Its IUPAC name is 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine.
Molecular Properties
| Compound Name | 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine |
| PubChem CID | 6539786 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine |
| SMILES | C(=C1/CCc2ccccc21)\c1ccncc1 |
| InChI | InChI=1S/C15H13N/c1-2-4-15-13(3-1)5-6-14(15)11-12-7-9-16-10-8-12/h1-4,7-11H,5-6H2/b14-11- |
| InChIKey | ZHGWOEHABOMOSV-KAMYIIQDSA-N |
| XLogP | 3.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine?
The IUPAC name of 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine (CID 6539786) is 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine.
What is the SMILES notation for 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine?
The canonical SMILES for 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine is C(=C1/CCc2ccccc21)\c1ccncc1.
What is the InChIKey of 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine?
The InChIKey is ZHGWOEHABOMOSV-KAMYIIQDSA-N. The full InChI is InChI=1S/C15H13N/c1-2-4-15-13(3-1)5-6-14(15)11-12-7-9-16-10-8-12/h1-4,7-11H,5-6H2/b14-11-.
What are the key properties of 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine?
4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine has a molecular weight of 207.28 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]pyridine is sourced from PubChem (CID 6539786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).