About 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride
2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride (PubChem CID 65398032) has the molecular formula C12H15BrClNO4S
and a molecular weight of 384.68 g/mol. Its IUPAC name is 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride |
| PubChem CID | 65398032 |
| Molecular Formula | C12H15BrClNO4S |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride |
| SMILES | CC1(C)CCCN(C(=O)c2cc(S(=O)(=O)Cl)c(Br)o2)C1 |
| InChI | InChI=1S/C12H15BrClNO4S/c1-12(2)4-3-5-15(7-12)11(16)8-6-9(10(13)19-8)20(14,17)18/h6H,3-5,7H2,1-2H3 |
| InChIKey | OCHRWLXULATHHK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride?
The IUPAC name of 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride (CID 65398032) is 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride.
What is the SMILES notation for 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride?
The canonical SMILES for 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride is CC1(C)CCCN(C(=O)c2cc(S(=O)(=O)Cl)c(Br)o2)C1.
What is the InChIKey of 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride?
The InChIKey is OCHRWLXULATHHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrClNO4S/c1-12(2)4-3-5-15(7-12)11(16)8-6-9(10(13)19-8)20(14,17)18/h6H,3-5,7H2,1-2H3.
What are the key properties of 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride?
2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride has a molecular weight of 384.68 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-(3,3-dimethylpiperidine-1-carbonyl)furan-3-sulfonyl chloride is sourced from PubChem (CID 65398032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).