About 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine
3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine (PubChem CID 6539819) has the molecular formula C21H17N
and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine.
Molecular Properties
| Compound Name | 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine |
| PubChem CID | 6539819 |
| Molecular Formula | C21H17N |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine |
| SMILES | C(=C1\CC(c2ccccc2)c2ccccc21)\c1cccnc1 |
| InChI | InChI=1S/C21H17N/c1-2-8-17(9-3-1)21-14-18(13-16-7-6-12-22-15-16)19-10-4-5-11-20(19)21/h1-13,15,21H,14H2/b18-13+ |
| InChIKey | ADQBWRCDKUIPFI-QGOAFFKASA-N |
| XLogP | 5.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine?
The IUPAC name of 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine (CID 6539819) is 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine.
What is the SMILES notation for 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine?
The canonical SMILES for 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine is C(=C1\CC(c2ccccc2)c2ccccc21)\c1cccnc1.
What is the InChIKey of 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine?
The InChIKey is ADQBWRCDKUIPFI-QGOAFFKASA-N. The full InChI is InChI=1S/C21H17N/c1-2-8-17(9-3-1)21-14-18(13-16-7-6-12-22-15-16)19-10-4-5-11-20(19)21/h1-13,15,21H,14H2/b18-13+.
What are the key properties of 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine?
3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine has a molecular weight of 283.37 g/mol, XLogP of 5.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-(3-phenyl-2,3-dihydroinden-1-ylidene)methyl]pyridine is sourced from PubChem (CID 6539819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).