About 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride
5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride (PubChem CID 65398806) has the molecular formula C14H20ClNO4S
and a molecular weight of 333.84 g/mol. Its IUPAC name is 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride |
| PubChem CID | 65398806 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride |
| SMILES | Cc1oc(C(=O)NC2CCC(C)(C)CC2)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C14H20ClNO4S/c1-9-12(21(15,18)19)8-11(20-9)13(17)16-10-4-6-14(2,3)7-5-10/h8,10H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | VHRYVTHLJCCBBV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride?
The IUPAC name of 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride (CID 65398806) is 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride.
What is the SMILES notation for 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride?
The canonical SMILES for 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride is Cc1oc(C(=O)NC2CCC(C)(C)CC2)cc1S(=O)(=O)Cl.
What is the InChIKey of 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride?
The InChIKey is VHRYVTHLJCCBBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO4S/c1-9-12(21(15,18)19)8-11(20-9)13(17)16-10-4-6-14(2,3)7-5-10/h8,10H,4-7H2,1-3H3,(H,16,17).
What are the key properties of 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride?
5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride has a molecular weight of 333.84 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,4-dimethylcyclohexyl)carbamoyl]-2-methylfuran-3-sulfonyl chloride is sourced from PubChem (CID 65398806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).