C22H24N4O — CID 6539893
(E)-N-methyl-N-[(1-methylindol-2-yl)methyl]-3-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)prop-2-enamide (PubChem CID 6539893) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is (E)-N-methyl-N-[(1-methylindol-2-yl)methyl]-3-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)prop-2-enamide.
| Compound Name | (E)-N-methyl-N-[(1-methylindol-2-yl)methyl]-3-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6539893 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (E)-N-methyl-N-[(1-methylindol-2-yl)methyl]-3-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)prop-2-enamide |
| SMILES | CN(Cc1cc2ccccc2n1C)C(=O)/C=C/c1cnc2c(c1)CCCN2 |
| InChI | InChI=1S/C22H24N4O/c1-25(15-19-13-17-6-3-4-8-20(17)26(19)2)21(27)10-9-16-12-18-7-5-11-23-22(18)24-14-16/h3-4,6,8-10,12-14H,5,7,11,15H2,1-2H3,(H,23,24)/b10-9+ |
| InChIKey | YWRXDGYUFPGSDH-MDZDMXLPSA-N |
| XLogP | 3.60 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|