About (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone
(9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone (PubChem CID 6539925) has the molecular formula C25H22N2O2
and a molecular weight of 382.46 g/mol. Its IUPAC name is (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone |
| PubChem CID | 6539925 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)N1CCc2c(n(Cc3ccccc3)c3ccccc23)C1 |
| InChI | InChI=1S/C25H22N2O2/c28-20-12-10-19(11-13-20)25(29)26-15-14-22-21-8-4-5-9-23(21)27(24(22)17-26)16-18-6-2-1-3-7-18/h1-13,28H,14-17H2 |
| InChIKey | QDFMACRGINWYFW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone?
The IUPAC name of (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone (CID 6539925) is (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone.
What is the SMILES notation for (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone?
The canonical SMILES for (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone is O=C(c1ccc(O)cc1)N1CCc2c(n(Cc3ccccc3)c3ccccc23)C1.
What is the InChIKey of (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone?
The InChIKey is QDFMACRGINWYFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N2O2/c28-20-12-10-19(11-13-20)25(29)26-15-14-22-21-8-4-5-9-23(21)27(24(22)17-26)16-18-6-2-1-3-7-18/h1-13,28H,14-17H2.
What are the key properties of (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone?
(9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone has a molecular weight of 382.46 g/mol, XLogP of 4.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)-(4-hydroxyphenyl)methanone is sourced from PubChem (CID 6539925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).