About methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate
methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate (PubChem CID 6539939) has the molecular formula C27H24N2O4
and a molecular weight of 440.50 g/mol. Its IUPAC name is methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate |
| PubChem CID | 6539939 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCc3c(n(Cc4ccc(O)cc4)c4ccccc34)C2)cc1 |
| InChI | InChI=1S/C27H24N2O4/c1-33-27(32)20-10-8-19(9-11-20)26(31)28-15-14-23-22-4-2-3-5-24(22)29(25(23)17-28)16-18-6-12-21(30)13-7-18/h2-13,30H,14-17H2,1H3 |
| InChIKey | XEKAUCBRVSEJEG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate?
The IUPAC name of methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate (CID 6539939) is methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate.
What is the SMILES notation for methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate?
The canonical SMILES for methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate is COC(=O)c1ccc(C(=O)N2CCc3c(n(Cc4ccc(O)cc4)c4ccccc34)C2)cc1.
What is the InChIKey of methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate?
The InChIKey is XEKAUCBRVSEJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N2O4/c1-33-27(32)20-10-8-19(9-11-20)26(31)28-15-14-23-22-4-2-3-5-24(22)29(25(23)17-28)16-18-6-12-21(30)13-7-18/h2-13,30H,14-17H2,1H3.
What are the key properties of methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate?
methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate has a molecular weight of 440.50 g/mol, XLogP of 4.38, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[9-[(4-hydroxyphenyl)methyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carbonyl]benzoate is sourced from PubChem (CID 6539939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).