C29H37N9O3S — CID 6539960
3-[3-methoxy-4-(phenylsulfamoylamino)phenyl]-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 6539960) has the molecular formula C29H37N9O3S and a molecular weight of 591.74 g/mol. Its IUPAC name is 3-[3-methoxy-4-(phenylsulfamoylamino)phenyl]-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-[3-methoxy-4-(phenylsulfamoylamino)phenyl]-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 6539960 |
| Molecular Formula | C29H37N9O3S |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | 3-[3-methoxy-4-(phenylsulfamoylamino)phenyl]-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COc1cc(-c2nn(C3CCC(N4CCN(C)CC4)CC3)c3ncnc(N)c23)ccc1NS(=O)(=O)Nc1ccccc1 |
| InChI | InChI=1S/C29H37N9O3S/c1-36-14-16-37(17-15-36)22-9-11-23(12-10-22)38-29-26(28(30)31-19-32-29)27(33-38)20-8-13-24(25(18-20)41-2)35-42(39,40)34-21-6-4-3-5-7-21/h3-8,13,18-19,22-23,34-35H,9-12,14-17H2,1-2H3,(H2,30,31,32) |
| InChIKey | QFTYUTZSERAYJG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'} |
|---|