C13H22N2S — CID 65399762
1-(2-cycloheptyl-1,3-thiazol-5-yl)-N-methylethanamine (PubChem CID 65399762) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 1-(2-cycloheptyl-1,3-thiazol-5-yl)-N-methylethanamine.
| Compound Name | 1-(2-cycloheptyl-1,3-thiazol-5-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 65399762 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-(2-cycloheptyl-1,3-thiazol-5-yl)-N-methylethanamine |
| SMILES | CNC(C)c1cnc(C2CCCCCC2)s1 |
| InChI | InChI=1S/C13H22N2S/c1-10(14-2)12-9-15-13(16-12)11-7-5-3-4-6-8-11/h9-11,14H,3-8H2,1-2H3 |
| InChIKey | MPYPUFPNMWSDED-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |