About 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid
3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid (PubChem CID 65399902) has the molecular formula C17H19NO2S
and a molecular weight of 301.41 g/mol. Its IUPAC name is 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid.
Molecular Properties
| Compound Name | 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid |
| PubChem CID | 65399902 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(-c2csc(C3CCCCCC3)n2)c1 |
| InChI | InChI=1S/C17H19NO2S/c19-17(20)14-9-5-8-13(10-14)15-11-21-16(18-15)12-6-3-1-2-4-7-12/h5,8-12H,1-4,6-7H2,(H,19,20) |
| InChIKey | JHQNDDVIIAPUJO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid?
The IUPAC name of 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid (CID 65399902) is 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid.
What is the SMILES notation for 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid?
The canonical SMILES for 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid is O=C(O)c1cccc(-c2csc(C3CCCCCC3)n2)c1.
What is the InChIKey of 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid?
The InChIKey is JHQNDDVIIAPUJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2S/c19-17(20)14-9-5-8-13(10-14)15-11-21-16(18-15)12-6-3-1-2-4-7-12/h5,8-12H,1-4,6-7H2,(H,19,20).
What are the key properties of 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid?
3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid has a molecular weight of 301.41 g/mol, XLogP of 4.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-cycloheptyl-1,3-thiazol-4-yl)benzoic acid is sourced from PubChem (CID 65399902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).