C18H29N3 — CID 65399990
2-cycloheptyl-N-propyl-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 65399990) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-cycloheptyl-N-propyl-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-cycloheptyl-N-propyl-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 65399990 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 2-cycloheptyl-N-propyl-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | CCCNc1nc(C2CCCCCC2)nc2c1CCCC2 |
| InChI | InChI=1S/C18H29N3/c1-2-13-19-18-15-11-7-8-12-16(15)20-17(21-18)14-9-5-3-4-6-10-14/h14H,2-13H2,1H3,(H,19,20,21) |
| InChIKey | OTGQWVYNPCSRDR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |