About 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea
1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea (PubChem CID 6540021) has the molecular formula C20H16FN5OS
and a molecular weight of 393.45 g/mol. Its IUPAC name is 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea.
Molecular Properties
| Compound Name | 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea |
| PubChem CID | 6540021 |
| Molecular Formula | C20H16FN5OS |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3csc4ncnc(N)c34)c(F)c2)c1 |
| InChI | InChI=1S/C20H16FN5OS/c1-11-3-2-4-12(7-11)25-20(27)26-13-5-6-14(16(21)8-13)15-9-28-19-17(15)18(22)23-10-24-19/h2-10H,1H3,(H2,22,23,24)(H2,25,26,27) |
| InChIKey | GWOSGFTZTVFDGQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea?
The IUPAC name of 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea (CID 6540021) is 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea.
What is the SMILES notation for 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea?
The canonical SMILES for 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea is Cc1cccc(NC(=O)Nc2ccc(-c3csc4ncnc(N)c34)c(F)c2)c1.
What is the InChIKey of 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea?
The InChIKey is GWOSGFTZTVFDGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FN5OS/c1-11-3-2-4-12(7-11)25-20(27)26-13-5-6-14(16(21)8-13)15-9-28-19-17(15)18(22)23-10-24-19/h2-10H,1H3,(H2,22,23,24)(H2,25,26,27).
What are the key properties of 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea?
1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea has a molecular weight of 393.45 g/mol, XLogP of 5.03, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-3-(3-methylphenyl)urea is sourced from PubChem (CID 6540021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).