C18H25FO — CID 65400283
(4-tert-butylcyclohexyl)-(4-fluoro-3-methylphenyl)methanone (PubChem CID 65400283) has the molecular formula C18H25FO and a molecular weight of 276.40 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl)-(4-fluoro-3-methylphenyl)methanone.
| Compound Name | (4-tert-butylcyclohexyl)-(4-fluoro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 65400283 |
| Molecular Formula | C18H25FO |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (4-tert-butylcyclohexyl)-(4-fluoro-3-methylphenyl)methanone |
| SMILES | Cc1cc(C(=O)C2CCC(C(C)(C)C)CC2)ccc1F |
| InChI | InChI=1S/C18H25FO/c1-12-11-14(7-10-16(12)19)17(20)13-5-8-15(9-6-13)18(2,3)4/h7,10-11,13,15H,5-6,8-9H2,1-4H3 |
| InChIKey | KUCALIUULFPNAB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |