About 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole
5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole (PubChem CID 6540032) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole |
| PubChem CID | 6540032 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole |
| SMILES | C(=C1\CCc2ccccc21)\c1cnc[nH]1 |
| InChI | InChI=1S/C13H12N2/c1-2-4-13-10(3-1)5-6-11(13)7-12-8-14-9-15-12/h1-4,7-9H,5-6H2,(H,14,15)/b11-7+ |
| InChIKey | FXLOWXDBTSZJFZ-YRNVUSSQSA-N |
| XLogP | 2.90 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole?
The IUPAC name of 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole (CID 6540032) is 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole.
What is the SMILES notation for 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole?
The canonical SMILES for 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole is C(=C1\CCc2ccccc21)\c1cnc[nH]1.
What is the InChIKey of 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole?
The InChIKey is FXLOWXDBTSZJFZ-YRNVUSSQSA-N. The full InChI is InChI=1S/C13H12N2/c1-2-4-13-10(3-1)5-6-11(13)7-12-8-14-9-15-12/h1-4,7-9H,5-6H2,(H,14,15)/b11-7+.
What are the key properties of 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole?
5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole has a molecular weight of 196.25 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1H-imidazole is sourced from PubChem (CID 6540032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).