About 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole
5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole (PubChem CID 6540037) has the molecular formula C14H13ClN2
and a molecular weight of 244.73 g/mol. Its IUPAC name is 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole |
| PubChem CID | 6540037 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole |
| SMILES | Clc1ccc2c(c1)/C(=C/c1cnc[nH]1)CCC2 |
| InChI | InChI=1S/C14H13ClN2/c15-12-5-4-10-2-1-3-11(14(10)7-12)6-13-8-16-9-17-13/h4-9H,1-3H2,(H,16,17)/b11-6+ |
| InChIKey | IXZHKLPXEBEKJV-IZZDOVSWSA-N |
| XLogP | 3.94 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole?
The IUPAC name of 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole (CID 6540037) is 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole.
What is the SMILES notation for 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole?
The canonical SMILES for 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole is Clc1ccc2c(c1)/C(=C/c1cnc[nH]1)CCC2.
What is the InChIKey of 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole?
The InChIKey is IXZHKLPXEBEKJV-IZZDOVSWSA-N. The full InChI is InChI=1S/C14H13ClN2/c15-12-5-4-10-2-1-3-11(14(10)7-12)6-13-8-16-9-17-13/h4-9H,1-3H2,(H,16,17)/b11-6+.
What are the key properties of 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole?
5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole has a molecular weight of 244.73 g/mol, XLogP of 3.94, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-(7-chloro-3,4-dihydro-2H-naphthalen-1-ylidene)methyl]-1H-imidazole is sourced from PubChem (CID 6540037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).