C11H17ClN2S — CID 65400393
5-chloro-3-(4-propylcyclohexyl)-1,2,4-thiadiazole (PubChem CID 65400393) has the molecular formula C11H17ClN2S and a molecular weight of 244.79 g/mol. Its IUPAC name is 5-chloro-3-(4-propylcyclohexyl)-1,2,4-thiadiazole.
| Compound Name | 5-chloro-3-(4-propylcyclohexyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 65400393 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-chloro-3-(4-propylcyclohexyl)-1,2,4-thiadiazole |
| SMILES | CCCC1CCC(c2nsc(Cl)n2)CC1 |
| InChI | InChI=1S/C11H17ClN2S/c1-2-3-8-4-6-9(7-5-8)10-13-11(12)15-14-10/h8-9H,2-7H2,1H3 |
| InChIKey | ISWAZTFDGYXNPT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |