C17H23N3O — CID 65401412
N-[[3-(3-ethylcyclohexyl)-1,2,4-oxadiazol-5-yl]methyl]aniline (PubChem CID 65401412) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[[3-(3-ethylcyclohexyl)-1,2,4-oxadiazol-5-yl]methyl]aniline.
| Compound Name | N-[[3-(3-ethylcyclohexyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 65401412 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-[[3-(3-ethylcyclohexyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
| SMILES | CCC1CCCC(c2noc(CNc3ccccc3)n2)C1 |
| InChI | InChI=1S/C17H23N3O/c1-2-13-7-6-8-14(11-13)17-19-16(21-20-17)12-18-15-9-4-3-5-10-15/h3-5,9-10,13-14,18H,2,6-8,11-12H2,1H3 |
| InChIKey | VRAUKBFLQSLJFE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |