About [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine
[3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine (PubChem CID 65401877) has the molecular formula C12H22F3NO
and a molecular weight of 253.31 g/mol. Its IUPAC name is [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine.
Molecular Properties
| Compound Name | [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine |
| PubChem CID | 65401877 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine |
| SMILES | CC1CCC(CN)(CCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H22F3NO/c1-10-3-5-11(7-10,8-16)4-2-6-17-9-12(13,14)15/h10H,2-9,16H2,1H3 |
| InChIKey | NWOAHGAXAYVLAG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine?
The IUPAC name of [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine (CID 65401877) is [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine.
What is the SMILES notation for [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine?
The canonical SMILES for [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine is CC1CCC(CN)(CCCOCC(F)(F)F)C1.
What is the InChIKey of [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine?
The InChIKey is NWOAHGAXAYVLAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3NO/c1-10-3-5-11(7-10,8-16)4-2-6-17-9-12(13,14)15/h10H,2-9,16H2,1H3.
What are the key properties of [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine?
[3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine has a molecular weight of 253.31 g/mol, XLogP of 3.11, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentyl]methanamine is sourced from PubChem (CID 65401877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).