About 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one
6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one (PubChem CID 6540212) has the molecular formula C23H19NO2
and a molecular weight of 341.41 g/mol. Its IUPAC name is 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one.
Molecular Properties
| Compound Name | 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one |
| PubChem CID | 6540212 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(-c3ccccc3)c2c(C)c1-c1cccc(N)c1 |
| InChI | InChI=1S/C23H19NO2/c1-14-11-20-23(15(2)22(14)17-9-6-10-18(24)12-17)19(13-21(25)26-20)16-7-4-3-5-8-16/h3-13H,24H2,1-2H3 |
| InChIKey | LCJUYXQAMPPVLP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one?
The IUPAC name of 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one (CID 6540212) is 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one.
What is the SMILES notation for 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one?
The canonical SMILES for 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one is Cc1cc2oc(=O)cc(-c3ccccc3)c2c(C)c1-c1cccc(N)c1.
What is the InChIKey of 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one?
The InChIKey is LCJUYXQAMPPVLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO2/c1-14-11-20-23(15(2)22(14)17-9-6-10-18(24)12-17)19(13-21(25)26-20)16-7-4-3-5-8-16/h3-13H,24H2,1-2H3.
What are the key properties of 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one?
6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one has a molecular weight of 341.41 g/mol, XLogP of 5.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-aminophenyl)-5,7-dimethyl-4-phenylchromen-2-one is sourced from PubChem (CID 6540212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).