C22H16O3S — CID 6540218
2-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)thiophene-3-carbaldehyde (PubChem CID 6540218) has the molecular formula C22H16O3S and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)thiophene-3-carbaldehyde.
| Compound Name | 2-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)thiophene-3-carbaldehyde |
|---|---|
| PubChem CID | 6540218 |
| Molecular Formula | C22H16O3S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)thiophene-3-carbaldehyde |
| SMILES | Cc1cc2oc(=O)cc(-c3ccccc3)c2c(C)c1-c1sccc1C=O |
| InChI | InChI=1S/C22H16O3S/c1-13-10-18-21(14(2)20(13)22-16(12-23)8-9-26-22)17(11-19(24)25-18)15-6-4-3-5-7-15/h3-12H,1-2H3 |
| InChIKey | VKUXYPNFVOVBCM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|