About ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate
ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate (PubChem CID 6540219) has the molecular formula C26H22O4
and a molecular weight of 398.46 g/mol. Its IUPAC name is ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate.
Molecular Properties
| Compound Name | ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate |
| PubChem CID | 6540219 |
| Molecular Formula | C26H22O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(-c2c(C)cc3oc(=O)cc(-c4ccccc4)c3c2C)cc1 |
| InChI | InChI=1S/C26H22O4/c1-4-29-26(28)20-12-10-19(11-13-20)24-16(2)14-22-25(17(24)3)21(15-23(27)30-22)18-8-6-5-7-9-18/h5-15H,4H2,1-3H3 |
| InChIKey | NIEGULALXXVMPL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate?
The IUPAC name of ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate (CID 6540219) is ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate.
What is the SMILES notation for ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate?
The canonical SMILES for ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate is CCOC(=O)c1ccc(-c2c(C)cc3oc(=O)cc(-c4ccccc4)c3c2C)cc1.
What is the InChIKey of ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate?
The InChIKey is NIEGULALXXVMPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22O4/c1-4-29-26(28)20-12-10-19(11-13-20)24-16(2)14-22-25(17(24)3)21(15-23(27)30-22)18-8-6-5-7-9-18/h5-15H,4H2,1-3H3.
What are the key properties of ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate?
ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate has a molecular weight of 398.46 g/mol, XLogP of 5.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(5,7-dimethyl-2-oxo-4-phenylchromen-6-yl)benzoate is sourced from PubChem (CID 6540219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).