About 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one
4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one (PubChem CID 6540227) has the molecular formula C25H23NO4
and a molecular weight of 401.46 g/mol. Its IUPAC name is 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one.
Molecular Properties
| Compound Name | 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one |
| PubChem CID | 6540227 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one |
| SMILES | COc1cc(OC)c2c(-c3cccc(-c4ccc(N(C)C)cc4)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H23NO4/c1-26(2)19-10-8-16(9-11-19)17-6-5-7-18(12-17)21-15-24(27)30-23-14-20(28-3)13-22(29-4)25(21)23/h5-15H,1-4H3 |
| InChIKey | OCJCDMHEKJJFGF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one?
The IUPAC name of 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one (CID 6540227) is 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one.
What is the SMILES notation for 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one?
The canonical SMILES for 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one is COc1cc(OC)c2c(-c3cccc(-c4ccc(N(C)C)cc4)c3)cc(=O)oc2c1.
What is the InChIKey of 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one?
The InChIKey is OCJCDMHEKJJFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO4/c1-26(2)19-10-8-16(9-11-19)17-6-5-7-18(12-17)21-15-24(27)30-23-14-20(28-3)13-22(29-4)25(21)23/h5-15H,1-4H3.
What are the key properties of 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one?
4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one has a molecular weight of 401.46 g/mol, XLogP of 5.21, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[4-(dimethylamino)phenyl]phenyl]-5,7-dimethoxychromen-2-one is sourced from PubChem (CID 6540227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).