C17H21N3 — CID 65403467
N-propyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidin-4-amine (PubChem CID 65403467) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is N-propyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidin-4-amine.
| Compound Name | N-propyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 65403467 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N-propyl-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidin-4-amine |
| SMILES | CCCNc1ccnc(C2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C17H21N3/c1-2-10-18-16-9-11-19-17(20-16)15-8-7-13-5-3-4-6-14(13)12-15/h3-6,9,11,15H,2,7-8,10,12H2,1H3,(H,18,19,20) |
| InChIKey | QKWBCNVZIXLJBN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |