About 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine
4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine (PubChem CID 65403944) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine |
| PubChem CID | 65403944 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine |
| SMILES | Cc1ccc(C)c(CC2(N)CCOc3ccccc32)c1 |
| InChI | InChI=1S/C18H21NO/c1-13-7-8-14(2)15(11-13)12-18(19)9-10-20-17-6-4-3-5-16(17)18/h3-8,11H,9-10,12,19H2,1-2H3 |
| InChIKey | GQWWWGBKGIAELA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine?
The IUPAC name of 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine (CID 65403944) is 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine.
What is the SMILES notation for 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine?
The canonical SMILES for 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine is Cc1ccc(C)c(CC2(N)CCOc3ccccc32)c1.
What is the InChIKey of 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine?
The InChIKey is GQWWWGBKGIAELA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO/c1-13-7-8-14(2)15(11-13)12-18(19)9-10-20-17-6-4-3-5-16(17)18/h3-8,11H,9-10,12,19H2,1-2H3.
What are the key properties of 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine?
4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine has a molecular weight of 267.37 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dimethylphenyl)methyl]-2,3-dihydrochromen-4-amine is sourced from PubChem (CID 65403944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).