About (3R)-3-(sulfanylmethyl)hexane-2,5-dione
(3R)-3-(sulfanylmethyl)hexane-2,5-dione (PubChem CID 6540420) has the molecular formula C7H12O2S
and a molecular weight of 160.24 g/mol. Its IUPAC name is (3R)-3-(sulfanylmethyl)hexane-2,5-dione.
Molecular Properties
| Compound Name | (3R)-3-(sulfanylmethyl)hexane-2,5-dione |
| PubChem CID | 6540420 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (3R)-3-(sulfanylmethyl)hexane-2,5-dione |
| SMILES | CC(=O)C[C@@H](CS)C(C)=O |
| InChI | InChI=1S/C7H12O2S/c1-5(8)3-7(4-10)6(2)9/h7,10H,3-4H2,1-2H3/t7-/m0/s1 |
| InChIKey | QSMTVJNEVPZRTC-ZETCQYMHSA-N |
| XLogP | 1.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(sulfanylmethyl)hexane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(sulfanylmethyl)hexane-2,5-dione?
The IUPAC name of (3R)-3-(sulfanylmethyl)hexane-2,5-dione (CID 6540420) is (3R)-3-(sulfanylmethyl)hexane-2,5-dione.
What is the SMILES notation for (3R)-3-(sulfanylmethyl)hexane-2,5-dione?
The canonical SMILES for (3R)-3-(sulfanylmethyl)hexane-2,5-dione is CC(=O)C[C@@H](CS)C(C)=O.
What is the InChIKey of (3R)-3-(sulfanylmethyl)hexane-2,5-dione?
The InChIKey is QSMTVJNEVPZRTC-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H12O2S/c1-5(8)3-7(4-10)6(2)9/h7,10H,3-4H2,1-2H3/t7-/m0/s1.
What are the key properties of (3R)-3-(sulfanylmethyl)hexane-2,5-dione?
(3R)-3-(sulfanylmethyl)hexane-2,5-dione has a molecular weight of 160.24 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(sulfanylmethyl)hexane-2,5-dione is sourced from PubChem (CID 6540420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).