C17H19NOS — CID 65405985
2-(1,2,3,4-tetrahydronaphthalen-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol (PubChem CID 65405985) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydronaphthalen-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol.
| Compound Name | 2-(1,2,3,4-tetrahydronaphthalen-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
|---|---|
| PubChem CID | 65405985 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(1,2,3,4-tetrahydronaphthalen-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
| SMILES | OC1CCCc2nc(C3CCc4ccccc4C3)sc21 |
| InChI | InChI=1S/C17H19NOS/c19-15-7-3-6-14-16(15)20-17(18-14)13-9-8-11-4-1-2-5-12(11)10-13/h1-2,4-5,13,15,19H,3,6-10H2 |
| InChIKey | YRNKCKWTXYRBJK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |