C11H11N3O2 — CID 65406401
3-(3,4-dihydro-2H-chromen-4-yl)-1,2,4-oxadiazol-5-amine (PubChem CID 65406401) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-4-yl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(3,4-dihydro-2H-chromen-4-yl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 65406401 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-4-yl)-1,2,4-oxadiazol-5-amine |
| SMILES | Nc1nc(C2CCOc3ccccc32)no1 |
| InChI | InChI=1S/C11H11N3O2/c12-11-13-10(14-16-11)8-5-6-15-9-4-2-1-3-7(8)9/h1-4,8H,5-6H2,(H2,12,13,14) |
| InChIKey | RWQYUCFVPZVEOC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |