About 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile
3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile (PubChem CID 65406884) has the molecular formula C16H19NO2
and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile.
Molecular Properties
| Compound Name | 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile |
| PubChem CID | 65406884 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile |
| SMILES | N#CC1(CC2CCOCC2)COc2ccccc2C1 |
| InChI | InChI=1S/C16H19NO2/c17-11-16(9-13-5-7-18-8-6-13)10-14-3-1-2-4-15(14)19-12-16/h1-4,13H,5-10,12H2 |
| InChIKey | IRNBYTODSXZFOY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile?
The IUPAC name of 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile (CID 65406884) is 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile.
What is the SMILES notation for 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile?
The canonical SMILES for 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile is N#CC1(CC2CCOCC2)COc2ccccc2C1.
What is the InChIKey of 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile?
The InChIKey is IRNBYTODSXZFOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2/c17-11-16(9-13-5-7-18-8-6-13)10-14-3-1-2-4-15(14)19-12-16/h1-4,13H,5-10,12H2.
What are the key properties of 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile?
3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile has a molecular weight of 257.33 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxan-4-ylmethyl)-2,4-dihydrochromene-3-carbonitrile is sourced from PubChem (CID 65406884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).