About (4-butyl-2,3-dihydrochromen-4-yl)methanamine
(4-butyl-2,3-dihydrochromen-4-yl)methanamine (PubChem CID 65407498) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is (4-butyl-2,3-dihydrochromen-4-yl)methanamine.
Molecular Properties
| Compound Name | (4-butyl-2,3-dihydrochromen-4-yl)methanamine |
| PubChem CID | 65407498 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (4-butyl-2,3-dihydrochromen-4-yl)methanamine |
| SMILES | CCCCC1(CN)CCOc2ccccc21 |
| InChI | InChI=1S/C14H21NO/c1-2-3-8-14(11-15)9-10-16-13-7-5-4-6-12(13)14/h4-7H,2-3,8-11,15H2,1H3 |
| InChIKey | HHYVKUMSGUFLCJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-butyl-2,3-dihydrochromen-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butyl-2,3-dihydrochromen-4-yl)methanamine?
The IUPAC name of (4-butyl-2,3-dihydrochromen-4-yl)methanamine (CID 65407498) is (4-butyl-2,3-dihydrochromen-4-yl)methanamine.
What is the SMILES notation for (4-butyl-2,3-dihydrochromen-4-yl)methanamine?
The canonical SMILES for (4-butyl-2,3-dihydrochromen-4-yl)methanamine is CCCCC1(CN)CCOc2ccccc21.
What is the InChIKey of (4-butyl-2,3-dihydrochromen-4-yl)methanamine?
The InChIKey is HHYVKUMSGUFLCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-2-3-8-14(11-15)9-10-16-13-7-5-4-6-12(13)14/h4-7H,2-3,8-11,15H2,1H3.
What are the key properties of (4-butyl-2,3-dihydrochromen-4-yl)methanamine?
(4-butyl-2,3-dihydrochromen-4-yl)methanamine has a molecular weight of 219.33 g/mol, XLogP of 2.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butyl-2,3-dihydrochromen-4-yl)methanamine is sourced from PubChem (CID 65407498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).