About N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide
N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide (PubChem CID 654082) has the molecular formula C24H30FN3O4
and a molecular weight of 443.52 g/mol. Its IUPAC name is N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide.
Molecular Properties
| Compound Name | N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide |
| PubChem CID | 654082 |
| Molecular Formula | C24H30FN3O4 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CN2CCC(NC(=O)c3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C24H30FN3O4/c1-3-31-20-8-9-22(32-4-2)21(15-20)27-23(29)16-28-12-10-19(11-13-28)26-24(30)17-6-5-7-18(25)14-17/h5-9,14-15,19H,3-4,10-13,16H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | JVMNOSIVRDMOOI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide?
The IUPAC name of N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide (CID 654082) is N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide.
What is the SMILES notation for N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide?
The canonical SMILES for N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide is CCOc1ccc(OCC)c(NC(=O)CN2CCC(NC(=O)c3cccc(F)c3)CC2)c1.
What is the InChIKey of N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide?
The InChIKey is JVMNOSIVRDMOOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30FN3O4/c1-3-31-20-8-9-22(32-4-2)21(15-20)27-23(29)16-28-12-10-19(11-13-28)26-24(30)17-6-5-7-18(25)14-17/h5-9,14-15,19H,3-4,10-13,16H2,1-2H3,(H,26,30)(H,27,29).
What are the key properties of N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide?
N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide has a molecular weight of 443.52 g/mol, XLogP of 3.46, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[2-(2,5-diethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-fluorobenzamide is sourced from PubChem (CID 654082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).