C11H11N3S — CID 65409055
3-(2,3-dihydro-1H-inden-2-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 65409055) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-2-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(2,3-dihydro-1H-inden-2-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65409055 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-2-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(C2Cc3ccccc3C2)ns1 |
| InChI | InChI=1S/C11H11N3S/c12-11-13-10(14-15-11)9-5-7-3-1-2-4-8(7)6-9/h1-4,9H,5-6H2,(H2,12,13,14) |
| InChIKey | KNMIPBOLOYFOJR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |