C14H14N4O3S — CID 6540927
(1S,2R,5R)-2-(4-methyl-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 6540927) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is (1S,2R,5R)-2-(4-methyl-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,2R,5R)-2-(4-methyl-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 6540927 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (1S,2R,5R)-2-(4-methyl-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | Cn1c(-c2cccnc2)nn([C@@H]2CC(=O)[C@@H]3OC[C@H]2O3)c1=S |
| InChI | InChI=1S/C14H14N4O3S/c1-17-12(8-3-2-4-15-6-8)16-18(14(17)22)9-5-10(19)13-20-7-11(9)21-13/h2-4,6,9,11,13H,5,7H2,1H3/t9-,11-,13-/m1/s1 |
| InChIKey | ZDLZDVQVPSPYEQ-IRUJWGPZSA-N |
| XLogP | 1.27 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|