C18H26O2 — CID 65409274
3-ethyl-1-[(4-propan-2-ylphenyl)methyl]cyclopentane-1-carboxylic acid (PubChem CID 65409274) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 3-ethyl-1-[(4-propan-2-ylphenyl)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 3-ethyl-1-[(4-propan-2-ylphenyl)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 65409274 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 3-ethyl-1-[(4-propan-2-ylphenyl)methyl]cyclopentane-1-carboxylic acid |
| SMILES | CCC1CCC(Cc2ccc(C(C)C)cc2)(C(=O)O)C1 |
| InChI | InChI=1S/C18H26O2/c1-4-14-9-10-18(11-14,17(19)20)12-15-5-7-16(8-6-15)13(2)3/h5-8,13-14H,4,9-12H2,1-3H3,(H,19,20) |
| InChIKey | FDROSQUMWZEIOA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |