C19H23NO — CID 65410502
1-(3,4-dihydro-2H-chromen-3-yl)-N-ethyl-2-phenylethanamine (PubChem CID 65410502) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-3-yl)-N-ethyl-2-phenylethanamine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-3-yl)-N-ethyl-2-phenylethanamine |
|---|---|
| PubChem CID | 65410502 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-3-yl)-N-ethyl-2-phenylethanamine |
| SMILES | CCNC(Cc1ccccc1)C1COc2ccccc2C1 |
| InChI | InChI=1S/C19H23NO/c1-2-20-18(12-15-8-4-3-5-9-15)17-13-16-10-6-7-11-19(16)21-14-17/h3-11,17-18,20H,2,12-14H2,1H3 |
| InChIKey | KUYYGPYPEAQSGY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |