About 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol
1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol (PubChem CID 65410779) has the molecular formula C16H24O
and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol |
| PubChem CID | 65410779 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)CCC(O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H24O/c1-16(2,3)9-8-15(17)14-10-12-6-4-5-7-13(12)11-14/h4-7,14-15,17H,8-11H2,1-3H3 |
| InChIKey | NIPWQBUGVWYUOH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol?
The IUPAC name of 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol (CID 65410779) is 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol?
The canonical SMILES for 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol is CC(C)(C)CCC(O)C1Cc2ccccc2C1.
What is the InChIKey of 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol?
The InChIKey is NIPWQBUGVWYUOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O/c1-16(2,3)9-8-15(17)14-10-12-6-4-5-7-13(12)11-14/h4-7,14-15,17H,8-11H2,1-3H3.
What are the key properties of 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol?
1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol has a molecular weight of 232.37 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 65410779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).