C15H15N3O — CID 6541176
benzotriazol-1-yl-[(1S,2S,4S)-2-methyl-2-bicyclo[2.2.1]hept-5-enyl]methanone (PubChem CID 6541176) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is benzotriazol-1-yl-[(1S,2S,4S)-2-methyl-2-bicyclo[2.2.1]hept-5-enyl]methanone.
| Compound Name | benzotriazol-1-yl-[(1S,2S,4S)-2-methyl-2-bicyclo[2.2.1]hept-5-enyl]methanone |
|---|---|
| PubChem CID | 6541176 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | benzotriazol-1-yl-[(1S,2S,4S)-2-methyl-2-bicyclo[2.2.1]hept-5-enyl]methanone |
| SMILES | C[C@]1(C(=O)n2nnc3ccccc32)C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C15H15N3O/c1-15(9-10-6-7-11(15)8-10)14(19)18-13-5-3-2-4-12(13)16-17-18/h2-7,10-11H,8-9H2,1H3/t10-,11+,15-/m0/s1 |
| InChIKey | IRLWUTSOOAFSNY-RWSFTLGLSA-N |
| XLogP | 2.67 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|