About 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine
1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine (PubChem CID 65412071) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine |
| PubChem CID | 65412071 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine |
| SMILES | CC(C)(C)CCC(N)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H25N/c1-16(2,3)9-8-15(17)14-10-12-6-4-5-7-13(12)11-14/h4-7,14-15H,8-11,17H2,1-3H3 |
| InChIKey | ZMIKVMCDRJRHLL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine?
The IUPAC name of 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine (CID 65412071) is 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine.
What is the SMILES notation for 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine?
The canonical SMILES for 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine is CC(C)(C)CCC(N)C1Cc2ccccc2C1.
What is the InChIKey of 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine?
The InChIKey is ZMIKVMCDRJRHLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N/c1-16(2,3)9-8-15(17)14-10-12-6-4-5-7-13(12)11-14/h4-7,14-15H,8-11,17H2,1-3H3.
What are the key properties of 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine?
1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine has a molecular weight of 231.38 g/mol, XLogP of 3.56, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1H-inden-2-yl)-4,4-dimethylpentan-1-amine is sourced from PubChem (CID 65412071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).