C21H16ClNO2 — CID 6541486
(1R,8R,9S,13R)-11-benzyl-14-chloro-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,14-tetraene-10,12-dione (PubChem CID 6541486) has the molecular formula C21H16ClNO2 and a molecular weight of 349.82 g/mol. Its IUPAC name is (1R,8R,9S,13R)-11-benzyl-14-chloro-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,14-tetraene-10,12-dione.
| Compound Name | (1R,8R,9S,13R)-11-benzyl-14-chloro-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,14-tetraene-10,12-dione |
|---|---|
| PubChem CID | 6541486 |
| Molecular Formula | C21H16ClNO2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (1R,8R,9S,13R)-11-benzyl-14-chloro-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,14-tetraene-10,12-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1Cc1ccccc1)[C@H]1C(Cl)=C[C@@H]2c2ccccc21 |
| InChI | InChI=1S/C21H16ClNO2/c22-16-10-15-13-8-4-5-9-14(13)17(16)19-18(15)20(24)23(21(19)25)11-12-6-2-1-3-7-12/h1-10,15,17-19H,11H2/t15-,17-,18+,19+/m1/s1 |
| InChIKey | LDVIVFKJRFNFMH-YSHGAJCASA-N |
| XLogP | 3.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|