C18H32N2S — CID 65415241
N-[[2-(4-tert-butylcyclohexyl)-4-methyl-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 65415241) has the molecular formula C18H32N2S and a molecular weight of 308.54 g/mol. Its IUPAC name is N-[[2-(4-tert-butylcyclohexyl)-4-methyl-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(4-tert-butylcyclohexyl)-4-methyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65415241 |
| Molecular Formula | C18H32N2S |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | N-[[2-(4-tert-butylcyclohexyl)-4-methyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(C2CCC(C(C)(C)C)CC2)nc1C |
| InChI | InChI=1S/C18H32N2S/c1-6-11-19-12-16-13(2)20-17(21-16)14-7-9-15(10-8-14)18(3,4)5/h14-15,19H,6-12H2,1-5H3 |
| InChIKey | XKLAQTHYBBWAFA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|