About 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde
2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 65415619) has the molecular formula C12H17NOS
and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 65415619 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CCC1CCCC(c2ncc(C=O)s2)C1 |
| InChI | InChI=1S/C12H17NOS/c1-2-9-4-3-5-10(6-9)12-13-7-11(8-14)15-12/h7-10H,2-6H2,1H3 |
| InChIKey | QMDRNHJOMDQOAU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde (CID 65415619) is 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde is CCC1CCCC(c2ncc(C=O)s2)C1.
What is the InChIKey of 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde?
The InChIKey is QMDRNHJOMDQOAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NOS/c1-2-9-4-3-5-10(6-9)12-13-7-11(8-14)15-12/h7-10H,2-6H2,1H3.
What are the key properties of 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde?
2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde has a molecular weight of 223.34 g/mol, XLogP of 3.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethylcyclohexyl)-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 65415619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).