About 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine
5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine (PubChem CID 65416617) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine |
| PubChem CID | 65416617 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine |
| SMILES | Cc1ccc(NCCc2nc(N)no2)cc1 |
| InChI | InChI=1S/C11H14N4O/c1-8-2-4-9(5-3-8)13-7-6-10-14-11(12)15-16-10/h2-5,13H,6-7H2,1H3,(H2,12,15) |
| InChIKey | JHQVLUHSUVMMIB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine (CID 65416617) is 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine is Cc1ccc(NCCc2nc(N)no2)cc1.
What is the InChIKey of 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine?
The InChIKey is JHQVLUHSUVMMIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c1-8-2-4-9(5-3-8)13-7-6-10-14-11(12)15-16-10/h2-5,13H,6-7H2,1H3,(H2,12,15).
What are the key properties of 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine?
5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine has a molecular weight of 218.26 g/mol, XLogP of 1.61, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-methylanilino)ethyl]-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 65416617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).