About 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol
2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol (PubChem CID 65416998) has the molecular formula C10H19N5O
and a molecular weight of 225.30 g/mol. Its IUPAC name is 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol |
| PubChem CID | 65416998 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol |
| SMILES | Cn1ncnc1CN1CCN(CCO)CC1 |
| InChI | InChI=1S/C10H19N5O/c1-13-10(11-9-12-13)8-15-4-2-14(3-5-15)6-7-16/h9,16H,2-8H2,1H3 |
| InChIKey | YYMOJHBRCXGCBM-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol?
The IUPAC name of 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol (CID 65416998) is 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol.
What is the SMILES notation for 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol?
The canonical SMILES for 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol is Cn1ncnc1CN1CCN(CCO)CC1.
What is the InChIKey of 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol?
The InChIKey is YYMOJHBRCXGCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5O/c1-13-10(11-9-12-13)8-15-4-2-14(3-5-15)6-7-16/h9,16H,2-8H2,1H3.
What are the key properties of 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol?
2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol has a molecular weight of 225.30 g/mol, XLogP of -1.08, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperazin-1-yl]ethanol is sourced from PubChem (CID 65416998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).