About 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine
5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine (PubChem CID 65417066) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine |
| PubChem CID | 65417066 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine |
| SMILES | Nc1ccc(N2CC=CC2)cn1 |
| InChI | InChI=1S/C9H11N3/c10-9-4-3-8(7-11-9)12-5-1-2-6-12/h1-4,7H,5-6H2,(H2,10,11) |
| InChIKey | NEWVRKSXRFYBNE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine?
The IUPAC name of 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine (CID 65417066) is 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine.
What is the SMILES notation for 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine?
The canonical SMILES for 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine is Nc1ccc(N2CC=CC2)cn1.
What is the InChIKey of 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine?
The InChIKey is NEWVRKSXRFYBNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c10-9-4-3-8(7-11-9)12-5-1-2-6-12/h1-4,7H,5-6H2,(H2,10,11).
What are the key properties of 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine?
5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine has a molecular weight of 161.21 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dihydropyrrol-1-yl)pyridin-2-amine is sourced from PubChem (CID 65417066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).