C8H16N2 — CID 65417497
4-(2,5-dihydropyrrol-1-yl)butan-2-amine (PubChem CID 65417497) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 4-(2,5-dihydropyrrol-1-yl)butan-2-amine.
| Compound Name | 4-(2,5-dihydropyrrol-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 65417497 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 4-(2,5-dihydropyrrol-1-yl)butan-2-amine |
| SMILES | CC(N)CCN1CC=CC1 |
| InChI | InChI=1S/C8H16N2/c1-8(9)4-7-10-5-2-3-6-10/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | ZYJZPNDWPSSDAM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|